Difference between revisions of "COUMARYL-ALCOHOL"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SEROTONIN == * common-name: ** serotonin * smiles: ** c([n+])cc1(=cnc2(c=cc(o)=cc1=2)) * inchi-key: ** qzaygjvttncvmb-uhfffaoysa-o * mole...")
(Created page with "Category:metabolite == Metabolite COUMARYL-ALCOHOL == * common-name: ** 4-coumaryl alcohol * smiles: ** c(=cc1(=cc=c(o)c=c1))co * inchi-key: ** ptnlhdgqwugons-owojbtedsa-n...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SEROTONIN ==
+
== Metabolite COUMARYL-ALCOHOL ==
 
* common-name:
 
* common-name:
** serotonin
+
** 4-coumaryl alcohol
 
* smiles:
 
* smiles:
** c([n+])cc1(=cnc2(c=cc(o)=cc1=2))
+
** c(=cc1(=cc=c(o)c=c1))co
 
* inchi-key:
 
* inchi-key:
** qzaygjvttncvmb-uhfffaoysa-o
+
** ptnlhdgqwugons-owojbtedsa-n
 
* molecular-weight:
 
* molecular-weight:
** 177.225
+
** 150.177
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10777]]
 
* [[RXN-10778]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN3DJ-170]]
+
* [[RXN-1102]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=serotonin}}
+
{{#set: common-name=4-coumaryl alcohol}}
{{#set: inchi-key=inchikey=qzaygjvttncvmb-uhfffaoysa-o}}
+
{{#set: inchi-key=inchikey=ptnlhdgqwugons-owojbtedsa-n}}
{{#set: molecular-weight=177.225}}
+
{{#set: molecular-weight=150.177}}

Latest revision as of 11:11, 18 March 2021

Metabolite COUMARYL-ALCOHOL

  • common-name:
    • 4-coumaryl alcohol
  • smiles:
    • c(=cc1(=cc=c(o)c=c1))co
  • inchi-key:
    • ptnlhdgqwugons-owojbtedsa-n
  • molecular-weight:
    • 150.177

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality