Difference between revisions of "COUMARYL-ALCOHOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite D-RIBULOSE-15-P2 == * common-name: ** d-ribulose-1,5-bisphosphate * smiles: ** c(op([o-])([o-])=o)c(o)c(o)c(=o)cop(=o)([o-])[o-] * inchi-...") |
(Created page with "Category:metabolite == Metabolite Protein-With-N-Terminal-Met == * common-name: ** a peptide with an n-terminal l-methionine == Reaction(s) known to consume the compound =...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Protein-With-N-Terminal-Met == |
* common-name: | * common-name: | ||
| − | ** | + | ** a peptide with an n-terminal l-methionine |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[3.4.11.18-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a peptide with an n-terminal l-methionine}} |
| − | |||
| − | |||
Revision as of 13:08, 14 January 2021
Contents
Metabolite Protein-With-N-Terminal-Met
- common-name:
- a peptide with an n-terminal l-methionine
