Difference between revisions of "COUMARYL-ALCOHOL"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Protein-With-N-Terminal-Met == * common-name: ** a peptide with an n-terminal l-methionine == Reaction(s) known to consume the compound =...") |
(Created page with "Category:metabolite == Metabolite 3-INDOLYLGLYCOLALDEHYDE == * common-name: ** indole-3-glycol aldehyde * smiles: ** c2(=c(c1(c=cc=cc=1n2))c(o)c=o) * inchi-key: ** xkzdnwm...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 3-INDOLYLGLYCOLALDEHYDE == |
* common-name: | * common-name: | ||
− | ** | + | ** indole-3-glycol aldehyde |
+ | * smiles: | ||
+ | ** c2(=c(c1(c=cc=cc=1n2))c(o)c=o) | ||
+ | * inchi-key: | ||
+ | ** xkzdnwmdlgqxml-uhfffaoysa-n | ||
+ | * molecular-weight: | ||
+ | ** 175.187 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN-5424]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=indole-3-glycol aldehyde}} |
+ | {{#set: inchi-key=inchikey=xkzdnwmdlgqxml-uhfffaoysa-n}} | ||
+ | {{#set: molecular-weight=175.187}} |
Revision as of 18:53, 14 January 2021
Contents
Metabolite 3-INDOLYLGLYCOLALDEHYDE
- common-name:
- indole-3-glycol aldehyde
- smiles:
- c2(=c(c1(c=cc=cc=1n2))c(o)c=o)
- inchi-key:
- xkzdnwmdlgqxml-uhfffaoysa-n
- molecular-weight:
- 175.187