Difference between revisions of "CPD-10198"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 7-AMINOMETHYL-7-DEAZAGUANINE == * common-name: ** preq1 * smiles: ** c([n+])c2(c1(c(=o)nc(n)=nc=1nc=2)) * inchi-key: ** meymblgokydglz-uh...") |
(Created page with "Category:metabolite == Metabolite CPD-10198 == * common-name: ** furaneol == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound == *...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-10198 == |
* common-name: | * common-name: | ||
− | ** | + | ** furaneol |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-9563]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=furaneol}} |
− | |||
− |
Latest revision as of 11:14, 18 March 2021
Contents
Metabolite CPD-10198
- common-name:
- furaneol