Difference between revisions of "CPD-10198"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18309 == * common-name: ** n-(r,r)-3-epoxysuccinamoyl-(s)-2,3-diaminopropanoyl-l-valine * smiles: ** cc(c)c(c([o-])=o)nc(=o)c([n+])cn...")
(Created page with "Category:metabolite == Metabolite CPD-10198 == * common-name: ** furaneol == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound == *...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-18309 ==
+
== Metabolite CPD-10198 ==
 
* common-name:
 
* common-name:
** n-(r,r)-3-epoxysuccinamoyl-(s)-2,3-diaminopropanoyl-l-valine
+
** furaneol
* smiles:
 
** cc(c)c(c([o-])=o)nc(=o)c([n+])cnc(=o)c1(oc(c(=o)n)1)
 
* inchi-key:
 
** hcgfosjnuodeoh-rulnzfcnsa-n
 
* molecular-weight:
 
** 316.313
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16991]]
+
* [[RXN-9563]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-(r,r)-3-epoxysuccinamoyl-(s)-2,3-diaminopropanoyl-l-valine}}
+
{{#set: common-name=furaneol}}
{{#set: inchi-key=inchikey=hcgfosjnuodeoh-rulnzfcnsa-n}}
 
{{#set: molecular-weight=316.313}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-10198

  • common-name:
    • furaneol

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality