Difference between revisions of "CPD-10244"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12321 == * common-name: ** 15-cis-phytoene * smiles: ** cc(c)=cccc(c)=cccc(c)=cccc(c)=cc=cc=c(ccc=c(ccc=c(ccc=c(c)c)c)c)c * inchi-key...") |
(Created page with "Category:metabolite == Metabolite CPD-85 == * common-name: ** 1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one * smiles: ** csccc(c([o-])=co)=o * inchi-key: ** cilxjjlqptuu...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-85 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one |
* smiles: | * smiles: | ||
| − | ** | + | ** csccc(c([o-])=co)=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** cilxjjlqptuuss-xqrvvysfsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 161.195 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[R147-RXN]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=cilxjjlqptuuss-xqrvvysfsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=161.195}} |
Revision as of 11:19, 15 January 2021
Contents
Metabolite CPD-85
- common-name:
- 1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one
- smiles:
- csccc(c([o-])=co)=o
- inchi-key:
- cilxjjlqptuuss-xqrvvysfsa-m
- molecular-weight:
- 161.195
