Difference between revisions of "CPD-10244"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-85 == * common-name: ** 1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one * smiles: ** csccc(c([o-])=co)=o * inchi-key: ** cilxjjlqptuu...")
(Created page with "Category:metabolite == Metabolite CPD-11555 == * common-name: ** octoketide * smiles: ** cc1(o)(cc(=o)c3(c(o1)=cc(o)=cc(cc2(oc(=o)c=c([o-])c=2))=3)) * inchi-key: ** wfnzgu...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-85 ==
+
== Metabolite CPD-11555 ==
 
* common-name:
 
* common-name:
** 1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one
+
** octoketide
 
* smiles:
 
* smiles:
** csccc(c([o-])=co)=o
+
** cc1(o)(cc(=o)c3(c(o1)=cc(o)=cc(cc2(oc(=o)c=c([o-])c=2))=3))
 
* inchi-key:
 
* inchi-key:
** cilxjjlqptuuss-xqrvvysfsa-m
+
** wfnzgunbscuxfx-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 161.195
+
** 317.274
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[R147-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-10734]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1,2-dihydroxy-5-(methylsulfanyl)pent-1-en-3-one}}
+
{{#set: common-name=octoketide}}
{{#set: inchi-key=inchikey=cilxjjlqptuuss-xqrvvysfsa-m}}
+
{{#set: inchi-key=inchikey=wfnzgunbscuxfx-uhfffaoysa-m}}
{{#set: molecular-weight=161.195}}
+
{{#set: molecular-weight=317.274}}

Revision as of 08:31, 15 March 2021

Metabolite CPD-11555

  • common-name:
    • octoketide
  • smiles:
    • cc1(o)(cc(=o)c3(c(o1)=cc(o)=cc(cc2(oc(=o)c=c([o-])c=2))=3))
  • inchi-key:
    • wfnzgunbscuxfx-uhfffaoysa-m
  • molecular-weight:
    • 317.274

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality