Difference between revisions of "CPD-10244"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11555 == * common-name: ** octoketide * smiles: ** cc1(o)(cc(=o)c3(c(o1)=cc(o)=cc(cc2(oc(=o)c=c([o-])c=2))=3)) * inchi-key: ** wfnzgu...") |
(Created page with "Category:metabolite == Metabolite CPD-10244 == * common-name: ** docosahexaenoate * smiles: ** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)[o-] * inchi-key: ** mbmbgcfofbjsgt-kubavdmb...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-10244 == |
* common-name: | * common-name: | ||
| − | ** | + | ** docosahexaenoate |
* smiles: | * smiles: | ||
| − | ** | + | ** ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)[o-] |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** mbmbgcfofbjsgt-kubavdmbsa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 327.486 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-16063]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-16017]] |
| + | * [[RXN-16063]] | ||
| + | * [[RXN-16138]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=docosahexaenoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=mbmbgcfofbjsgt-kubavdmbsa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=327.486}} |
Latest revision as of 11:17, 18 March 2021
Contents
Metabolite CPD-10244
- common-name:
- docosahexaenoate
- smiles:
- ccc=ccc=ccc=ccc=ccc=ccc=cccc(=o)[o-]
- inchi-key:
- mbmbgcfofbjsgt-kubavdmbsa-m
- molecular-weight:
- 327.486
