Difference between revisions of "CPD-10244"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIMETHUROPORDEHYDROG-RXN DIMETHUROPORDEHYDROG-RXN] == * direction: ** left-to-right * common-name:...")
(Created page with "Category:metabolite == Metabolite CPD-17346 == * common-name: ** 3-oxo-(11z,14z)-icosa-11,14-dienoyl-coa * smiles: ** cccccc=ccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(...")
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DIMETHUROPORDEHYDROG-RXN DIMETHUROPORDEHYDROG-RXN] ==
+
== Metabolite CPD-17346 ==
* direction:
 
** left-to-right
 
 
* common-name:
 
* common-name:
** precorrin-2 dehydrogenase
+
** 3-oxo-(11z,14z)-icosa-11,14-dienoyl-coa
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/1.3.1.76 ec-1.3.1.76]
+
** cccccc=ccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
== Reaction formula ==
+
* inchi-key:
* 1 [[DIHYDROSIROHYDROCHLORIN]][c] '''+''' 1 [[NAD]][c] '''=>''' 1 [[NADH]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[SIROHYDROCHLORIN]][c]
+
** puwduocpcwfefg-ygyqdceasa-j
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ12313]]
+
** 1067.974
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: go-term, Comment: n.a
+
* [[RXN-16095]]
== Pathway(s) ==
+
== Reaction(s) known to produce the compound ==
* [[PWY-7377]], cob(II)yrinate a,c-diamide biosynthesis I (early cobalt insertion): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7377 PWY-7377]
+
* [[RXN-16094]]
** '''4''' reactions found over '''15''' reactions in the full pathway
+
== Reaction(s) of unknown directionality ==
* [[PWY-5196]], factor 430 biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5196 PWY-5196]
+
{{#set: common-name=3-oxo-(11z,14z)-icosa-11,14-dienoyl-coa}}
** '''3''' reactions found over '''7''' reactions in the full pathway
+
{{#set: inchi-key=inchikey=puwduocpcwfefg-ygyqdceasa-j}}
* [[PWY-5194]], siroheme biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5194 PWY-5194]
+
{{#set: molecular-weight=1067.974}}
** '''4''' reactions found over '''4''' reactions in the full pathway
 
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15613 15613]
 
* LIGAND-RXN:
 
** [http://www.genome.jp/dbget-bin/www_bget?R03947 R03947]
 
{{#set: direction=left-to-right}}
 
{{#set: common-name=precorrin-2 dehydrogenase}}
 
{{#set: ec-number=ec-1.3.1.76}}
 
{{#set: nb gene associated=1}}
 
{{#set: nb pathway associated=3}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Revision as of 20:37, 18 December 2020

Metabolite CPD-17346

  • common-name:
    • 3-oxo-(11z,14z)-icosa-11,14-dienoyl-coa
  • smiles:
    • cccccc=ccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • puwduocpcwfefg-ygyqdceasa-j
  • molecular-weight:
    • 1067.974

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality