Difference between revisions of "CPD-10244"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17346 == * common-name: ** 3-oxo-(11z,14z)-icosa-11,14-dienoyl-coa * smiles: ** cccccc=ccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(...")
(Created page with "Category:metabolite == Metabolite CPD-17292 == * common-name: ** a [glycerolipid]-(7z,10z,13z)-hexadecatrienoate == Reaction(s) known to consume the compound == == Reactio...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-17346 ==
+
== Metabolite CPD-17292 ==
 
* common-name:
 
* common-name:
** 3-oxo-(11z,14z)-icosa-11,14-dienoyl-coa
+
** a [glycerolipid]-(7z,10z,13z)-hexadecatrienoate
* smiles:
 
** cccccc=ccc=ccccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
** puwduocpcwfefg-ygyqdceasa-j
 
* molecular-weight:
 
** 1067.974
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-16095]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16094]]
+
* [[RXN-16049]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-oxo-(11z,14z)-icosa-11,14-dienoyl-coa}}
+
{{#set: common-name=a [glycerolipid]-(7z,10z,13z)-hexadecatrienoate}}
{{#set: inchi-key=inchikey=puwduocpcwfefg-ygyqdceasa-j}}
 
{{#set: molecular-weight=1067.974}}
 

Revision as of 14:59, 5 January 2021

Metabolite CPD-17292

  • common-name:
    • a [glycerolipid]-(7z,10z,13z)-hexadecatrienoate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [glycerolipid]-(7z,10z,13z)-hexadecatrienoate" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.