Difference between revisions of "CPD-10254"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Decanoyl-ACPs == * common-name: ** a decanoyl-[acp] == Reaction(s) known to consume the compound == * RXN-9531 * RXN-9652 == Reac...") |
(Created page with "Category:metabolite == Metabolite CPD-10254 == * common-name: ** (9z,12z)-hexadeca-9,12-dienoyl-coa * smiles: ** cccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-10254 == |
* common-name: | * common-name: | ||
− | ** | + | ** (9z,12z)-hexadeca-9,12-dienoyl-coa |
+ | * smiles: | ||
+ | ** cccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
+ | * inchi-key: | ||
+ | ** cqxsjfxwargobe-pcrjdaltsa-j | ||
+ | * molecular-weight: | ||
+ | ** 997.883 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-9616]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=(9z,12z)-hexadeca-9,12-dienoyl-coa}} |
+ | {{#set: inchi-key=inchikey=cqxsjfxwargobe-pcrjdaltsa-j}} | ||
+ | {{#set: molecular-weight=997.883}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-10254
- common-name:
- (9z,12z)-hexadeca-9,12-dienoyl-coa
- smiles:
- cccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- inchi-key:
- cqxsjfxwargobe-pcrjdaltsa-j
- molecular-weight:
- 997.883