Difference between revisions of "CPD-10254"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ05463 == * transcription-direction: ** positive * right-end-position: ** 31709 * left-end-position: ** 21415 * centisome-position: ** 23.42844...")
 
(Created page with "Category:metabolite == Metabolite CPD-10254 == * common-name: ** (9z,12z)-hexadeca-9,12-dienoyl-coa * smiles: ** cccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:gene]]
+
[[Category:metabolite]]
== Gene SJ05463 ==
+
== Metabolite CPD-10254 ==
* transcription-direction:
+
* common-name:
** positive
+
** (9z,12z)-hexadeca-9,12-dienoyl-coa
* right-end-position:
+
* smiles:
** 31709
+
** cccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
* left-end-position:
+
* inchi-key:
** 21415
+
** cqxsjfxwargobe-pcrjdaltsa-j
* centisome-position:
+
* molecular-weight:
** 23.42844   
+
** 997.883
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
* [[S.japonica_carotenoid_curated]]
+
== Reaction(s) known to produce the compound ==
== Reaction(s) associated ==
+
* [[RXN-9616]]
* [[3.1.4.1-RXN]]
+
== Reaction(s) of unknown directionality ==
** Category: [[annotation]]
+
{{#set: common-name=(9z,12z)-hexadeca-9,12-dienoyl-coa}}
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=cqxsjfxwargobe-pcrjdaltsa-j}}
{{#set: transcription-direction=positive}}
+
{{#set: molecular-weight=997.883}}
{{#set: right-end-position=31709}}
 
{{#set: left-end-position=21415}}
 
{{#set: centisome-position=23.42844    }}
 
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
{{#set: nb reaction associated=1}}
 

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-10254

  • common-name:
    • (9z,12z)-hexadeca-9,12-dienoyl-coa
  • smiles:
    • cccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • cqxsjfxwargobe-pcrjdaltsa-j
  • molecular-weight:
    • 997.883

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality