Difference between revisions of "CPD-10254"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite N-ACETYL-9-O-ACETYLNEURAMINATE == * common-name: ** n-acetyl-9-o-acetylneuraminate * smiles: ** cc(nc1(c(cc(o)(c(=o)[o-])oc1c(c(coc(=o)c)...")
(Created page with "Category:metabolite == Metabolite CPD-10254 == * common-name: ** (9z,12z)-hexadeca-9,12-dienoyl-coa * smiles: ** cccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite N-ACETYL-9-O-ACETYLNEURAMINATE ==
+
== Metabolite CPD-10254 ==
 
* common-name:
 
* common-name:
** n-acetyl-9-o-acetylneuraminate
+
** (9z,12z)-hexadeca-9,12-dienoyl-coa
 
* smiles:
 
* smiles:
** cc(nc1(c(cc(o)(c(=o)[o-])oc1c(c(coc(=o)c)o)o)o))=o
+
** cccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** nywzbrwkdrmpas-gyqvtdhrsa-m
+
** cqxsjfxwargobe-pcrjdaltsa-j
 
* molecular-weight:
 
* molecular-weight:
** 350.302
+
** 997.883
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-7864]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-7864]]
+
* [[RXN-9616]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=n-acetyl-9-o-acetylneuraminate}}
+
{{#set: common-name=(9z,12z)-hexadeca-9,12-dienoyl-coa}}
{{#set: inchi-key=inchikey=nywzbrwkdrmpas-gyqvtdhrsa-m}}
+
{{#set: inchi-key=inchikey=cqxsjfxwargobe-pcrjdaltsa-j}}
{{#set: molecular-weight=350.302}}
+
{{#set: molecular-weight=997.883}}

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-10254

  • common-name:
    • (9z,12z)-hexadeca-9,12-dienoyl-coa
  • smiles:
    • cccc=ccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • cqxsjfxwargobe-pcrjdaltsa-j
  • molecular-weight:
    • 997.883

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality