Difference between revisions of "CPD-10260"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite METOH == * common-name: ** methanol * smiles: ** co * inchi-key: ** okkjlvbelutlkv-uhfffaoysa-n * molecular-weight: ** 32.042 == Reaction...") |
(Created page with "Category:metabolite == Metabolite CPD-8079 == * common-name: ** 1-18:1-2-16:3-monogalactosyldiacylglycerol * smiles: ** ccccccccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-8079 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 1-18:1-2-16:3-monogalactosyldiacylglycerol |
* smiles: | * smiles: | ||
| − | ** co | + | ** ccccccccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=ccc=ccc)=o)=o |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** uledcqdcqahgfd-lukloydesa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 751.052 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-8303]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=1-18:1-2-16:3-monogalactosyldiacylglycerol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=uledcqdcqahgfd-lukloydesa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=751.052}} |
Revision as of 08:24, 15 March 2021
Contents
Metabolite CPD-8079
- common-name:
- 1-18:1-2-16:3-monogalactosyldiacylglycerol
- smiles:
- ccccccccc=ccccccccc(occ(coc1(oc(c(c(c1o)o)o)co))oc(cccccc=ccc=ccc=ccc)=o)=o
- inchi-key:
- uledcqdcqahgfd-lukloydesa-n
- molecular-weight:
- 751.052
