Difference between revisions of "CPD-10260"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite SINAPATE == * common-name: ** sinapate * smiles: ** coc1(c=c(c=c(oc)c(o)=1)c=cc([o-])=o) * inchi-key: ** pcmortlopmlefb-onegzznksa-m * mo...") |
(Created page with "Category:metabolite == Metabolite Pectin == * common-name: ** a pectin == Reaction(s) known to consume the compound == * 4.2.2.10-RXN * RXN-14897 == Reaction(s) kn...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Pectin == |
* common-name: | * common-name: | ||
− | ** | + | ** a pectin |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[4.2.2.10-RXN]] |
+ | * [[RXN-14897]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[4.2.2.10-RXN]] |
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a pectin}} |
− | |||
− |
Revision as of 18:52, 14 January 2021
Contents
Metabolite Pectin
- common-name:
- a pectin