Difference between revisions of "CPD-10260"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite SINAPATE == * common-name: ** sinapate * smiles: ** coc1(c=c(c=c(oc)c(o)=1)c=cc([o-])=o) * inchi-key: ** pcmortlopmlefb-onegzznksa-m * mo...")
(Created page with "Category:metabolite == Metabolite Pectin == * common-name: ** a pectin == Reaction(s) known to consume the compound == * 4.2.2.10-RXN * RXN-14897 == Reaction(s) kn...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite SINAPATE ==
+
== Metabolite Pectin ==
 
* common-name:
 
* common-name:
** sinapate
+
** a pectin
* smiles:
 
** coc1(c=c(c=c(oc)c(o)=1)c=cc([o-])=o)
 
* inchi-key:
 
** pcmortlopmlefb-onegzznksa-m
 
* molecular-weight:
 
** 223.205
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10919]]
+
* [[4.2.2.10-RXN]]
 +
* [[RXN-14897]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-3422]]
+
* [[4.2.2.10-RXN]]
* [[RXN-8014]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=sinapate}}
+
{{#set: common-name=a pectin}}
{{#set: inchi-key=inchikey=pcmortlopmlefb-onegzznksa-m}}
 
{{#set: molecular-weight=223.205}}
 

Revision as of 18:52, 14 January 2021

Metabolite Pectin

  • common-name:
    • a pectin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality