Difference between revisions of "CPD-10262"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-17063 == * common-name: ** ferroheme o * smiles: ** c=cc4(=c(c)c8(=[n+]5([fe--]26([n+]1(=c(c(c)=c(ccc(=o)[o-])c1=cc3(n2c(=c(c)c(ccc(=...") |
(Created page with "Category:metabolite == Metabolite CPD-15836 == * common-name: ** α-tocotrienol * smiles: ** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=c(c(=c(c=2c)c)o)c)))c)c)c * inchi-key...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-15836 == |
* common-name: | * common-name: | ||
| − | ** | + | ** α-tocotrienol |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=c(c(=c(c=2c)c)o)c)))c)c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** rzfhlolgzpdchj-xzxlulotsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 424.665 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-14918]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=α-tocotrienol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rzfhlolgzpdchj-xzxlulotsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=424.665}} |
Revision as of 13:10, 14 January 2021
Contents
Metabolite CPD-15836
- common-name:
- α-tocotrienol
- smiles:
- cc(=cccc(=cccc(=cccc1(c)(oc2(c(cc1)=c(c(=c(c=2c)c)o)c)))c)c)c
- inchi-key:
- rzfhlolgzpdchj-xzxlulotsa-n
- molecular-weight:
- 424.665
