Difference between revisions of "CPD-10269"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite BUTANAL == * common-name: ** butan-1-al * smiles: ** ccc[ch]=o * inchi-key: ** ztqsagdemfdkmz-uhfffaoysa-n * molecular-weight: ** 72.107...")
(Created page with "Category:metabolite == Metabolite CPD-10269 == * common-name: ** palmitoleoyl-coa * smiles: ** ccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o...")
 
(3 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite BUTANAL ==
+
== Metabolite CPD-10269 ==
 
* common-name:
 
* common-name:
** butan-1-al
+
** palmitoleoyl-coa
 
* smiles:
 
* smiles:
** ccc[ch]=o
+
** ccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** ztqsagdemfdkmz-uhfffaoysa-n
+
** qbyoccwnzaoztl-mdmkaecgsa-j
 
* molecular-weight:
 
* molecular-weight:
** 72.107
+
** 999.899
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[BTS_LPAREN_nadph_RPAREN_]]
+
* [[RXN-10662]]
* [[RXN-161]]
+
* [[RXN-17008]]
 +
* [[RXN-17009]]
 +
* [[RXN-17019]]
 +
* [[RXN-17788]]
 +
* [[RXN-9616]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-161]]
+
* [[RXN-10664]]
 +
* [[RXN-17787]]
 +
* [[RXN0-7248]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=butan-1-al}}
+
{{#set: common-name=palmitoleoyl-coa}}
{{#set: inchi-key=inchikey=ztqsagdemfdkmz-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=qbyoccwnzaoztl-mdmkaecgsa-j}}
{{#set: molecular-weight=72.107}}
+
{{#set: molecular-weight=999.899}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-10269

  • common-name:
    • palmitoleoyl-coa
  • smiles:
    • ccccccc=ccccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • inchi-key:
    • qbyoccwnzaoztl-mdmkaecgsa-j
  • molecular-weight:
    • 999.899

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality