Difference between revisions of "CPD-10283"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-8091 == * common-name: ** 1-oleoyl-2-linoleoyl-phosphatidylcholine * smiles: ** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc)cop...")
(Created page with "Category:metabolite == Metabolite CPD-10283 == * common-name: ** 3-oxo-behenoyl-coa * smiles: ** cccccccccccccccccccc(=o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-8091 ==
+
== Metabolite CPD-10283 ==
 
* common-name:
 
* common-name:
** 1-oleoyl-2-linoleoyl-phosphatidylcholine
+
** 3-oxo-behenoyl-coa
 
* smiles:
 
* smiles:
** ccccccccc=ccccccccc(occ(oc(=o)cccccccc=ccc=cccccc)cop([o-])(=o)occ[n+](c)(c)c)=o
+
** cccccccccccccccccccc(=o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
 
* inchi-key:
 
* inchi-key:
** gdwulugdxghjij-vjhnmzkjsa-n
+
** rkcogguhkptoqj-gnsuaqhmsa-j
 
* molecular-weight:
 
* molecular-weight:
** 784.107
+
** 1100.059
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8322]]
+
* [[RXN-13299]]
* [[RXN-8326]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8327]]
+
* [[RXN-13295]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-oleoyl-2-linoleoyl-phosphatidylcholine}}
+
{{#set: common-name=3-oxo-behenoyl-coa}}
{{#set: inchi-key=inchikey=gdwulugdxghjij-vjhnmzkjsa-n}}
+
{{#set: inchi-key=inchikey=rkcogguhkptoqj-gnsuaqhmsa-j}}
{{#set: molecular-weight=784.107}}
+
{{#set: molecular-weight=1100.059}}

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-10283

  • common-name:
    • 3-oxo-behenoyl-coa
  • smiles:
    • cccccccccccccccccccc(=o)cc(=o)sccnc(=o)ccnc(c(o)c(c)(c)cop([o-])(=o)op([o-])(=o)occ1(c(op(=o)([o-])[o-])c(o)c(o1)n3(c=nc2(c(n)=nc=nc=23))))=o
  • inchi-key:
    • rkcogguhkptoqj-gnsuaqhmsa-j
  • molecular-weight:
    • 1100.059

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality