Difference between revisions of "CPD-10284"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15172 == * common-name: ** 6,7-dehydrobaicalein * smiles: ** c1(c=cc(=cc=1)c2(=cc(=o)c3(c(o2)=cc(=o)c(=o)c(o)=3))) * inchi-key: ** ls...")
(Created page with "Category:metabolite == Metabolite I-antigens == * common-name: ** an i antigen == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15172 ==
+
== Metabolite I-antigens ==
 
* common-name:
 
* common-name:
** 6,7-dehydrobaicalein
+
** an i antigen
* smiles:
 
** c1(c=cc(=cc=1)c2(=cc(=o)c3(c(o2)=cc(=o)c(=o)c(o)=3)))
 
* inchi-key:
 
** lsqwciyrgvwpfx-uhfffaoysa-n
 
* molecular-weight:
 
** 268.225
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14240]]
+
* [[RXN-15278]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6,7-dehydrobaicalein}}
+
{{#set: common-name=an i antigen}}
{{#set: inchi-key=inchikey=lsqwciyrgvwpfx-uhfffaoysa-n}}
 
{{#set: molecular-weight=268.225}}
 

Revision as of 11:14, 15 January 2021

Metabolite I-antigens

  • common-name:
    • an i antigen

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality