Difference between revisions of "CPD-10284"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Cysteine-Desulfurase-L-cysteine == * common-name: ** an [l-cysteine desulfurase]-l-cysteine == Reaction(s) known to consume the compound...") |
(Created page with "Category:metabolite == Metabolite CPD-15172 == * common-name: ** 6,7-dehydrobaicalein * smiles: ** c1(c=cc(=cc=1)c2(=cc(=o)c3(c(o2)=cc(=o)c(=o)c(o)=3))) * inchi-key: ** ls...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-15172 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 6,7-dehydrobaicalein |
| + | * smiles: | ||
| + | ** c1(c=cc(=cc=1)c2(=cc(=o)c3(c(o2)=cc(=o)c(=o)c(o)=3))) | ||
| + | * inchi-key: | ||
| + | ** lsqwciyrgvwpfx-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 268.225 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-14240]] |
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=6,7-dehydrobaicalein}} |
| + | {{#set: inchi-key=inchikey=lsqwciyrgvwpfx-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=268.225}} | ||
Revision as of 15:26, 5 January 2021
Contents
Metabolite CPD-15172
- common-name:
- 6,7-dehydrobaicalein
- smiles:
- c1(c=cc(=cc=1)c2(=cc(=o)c3(c(o2)=cc(=o)c(=o)c(o)=3)))
- inchi-key:
- lsqwciyrgvwpfx-uhfffaoysa-n
- molecular-weight:
- 268.225
