Difference between revisions of "CPD-10284"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ18507 == * transcription-direction: ** positive * right-end-position: ** 124013 * left-end-position: ** 112781 * centisome-position: ** 46.342514...") |
(Created page with "Category:metabolite == Metabolite CPD-12706 == * common-name: ** 5-fluoro-5-deoxy-d-ribose 1-phosphate * smiles: ** c(c1(oc(op([o-])(=o)[o-])c(o)c1o))f * inchi-key: ** luq...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:metabolite]] |
− | == | + | == Metabolite CPD-12706 == |
− | * | + | * common-name: |
− | ** | + | ** 5-fluoro-5-deoxy-d-ribose 1-phosphate |
− | * | + | * smiles: |
− | ** | + | ** c(c1(oc(op([o-])(=o)[o-])c(o)c1o))f |
− | * | + | * inchi-key: |
− | ** | + | ** luqfmenctwebsq-txicztdvsa-l |
− | * | + | * molecular-weight: |
− | ** | + | ** 230.086 |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | == Reaction(s) | + | * [[RXN-11743]] |
− | * [[ | + | == Reaction(s) of unknown directionality == |
− | + | {{#set: common-name=5-fluoro-5-deoxy-d-ribose 1-phosphate}} | |
− | + | {{#set: inchi-key=inchikey=luqfmenctwebsq-txicztdvsa-l}} | |
− | + | {{#set: molecular-weight=230.086}} | |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | {{#set: | ||
− | |||
− | |||
− | {{#set: | ||
− | {{#set: | ||
− | |||
− |
Revision as of 20:32, 18 December 2020
Contents
Metabolite CPD-12706
- common-name:
- 5-fluoro-5-deoxy-d-ribose 1-phosphate
- smiles:
- c(c1(oc(op([o-])(=o)[o-])c(o)c1o))f
- inchi-key:
- luqfmenctwebsq-txicztdvsa-l
- molecular-weight:
- 230.086