Difference between revisions of "CPD-10330"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19144 == * common-name: ** (7z)-hexadecenoyl-coa * smiles: ** ccccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(...")
(Created page with "Category:metabolite == Metabolite CPD-10330 == * common-name: ** α-d-ribofuranose * smiles: ** c(c1(c(c(c(o1)o)o)o))o * inchi-key: ** hmfhbzshggewlo-aihaylrmsa-n * m...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19144 ==
+
== Metabolite CPD-10330 ==
 
* common-name:
 
* common-name:
** (7z)-hexadecenoyl-coa
+
** α-d-ribofuranose
 
* smiles:
 
* smiles:
** ccccccccc=ccccccc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c(c1(c(c(c(o1)o)o)o))o
 
* inchi-key:
 
* inchi-key:
** mjwmoldkmbisob-ydggzukgsa-j
+
** hmfhbzshggewlo-aihaylrmsa-n
 
* molecular-weight:
 
* molecular-weight:
** 999.899
+
** 150.131
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17779]]
+
* [[RIBOKIN-RXN]]
 +
* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17778]]
+
* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(7z)-hexadecenoyl-coa}}
+
{{#set: common-name=α-d-ribofuranose}}
{{#set: inchi-key=inchikey=mjwmoldkmbisob-ydggzukgsa-j}}
+
{{#set: inchi-key=inchikey=hmfhbzshggewlo-aihaylrmsa-n}}
{{#set: molecular-weight=999.899}}
+
{{#set: molecular-weight=150.131}}

Latest revision as of 11:11, 18 March 2021

Metabolite CPD-10330

  • common-name:
    • α-d-ribofuranose
  • smiles:
    • c(c1(c(c(c(o1)o)o)o))o
  • inchi-key:
    • hmfhbzshggewlo-aihaylrmsa-n
  • molecular-weight:
    • 150.131

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality