Difference between revisions of "CPD-10330"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ITP == * common-name: ** itp * smiles: ** c(op(=o)([o-])op([o-])(=o)op([o-])([o-])=o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-ke...") |
(Created page with "Category:metabolite == Metabolite CPD-10330 == * common-name: ** α-d-ribofuranose * smiles: ** c(c1(c(c(c(o1)o)o)o))o * inchi-key: ** hmfhbzshggewlo-aihaylrmsa-n * m...") |
||
(6 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-10330 == |
* common-name: | * common-name: | ||
− | ** | + | ** α-d-ribofuranose |
* smiles: | * smiles: | ||
− | ** c( | + | ** c(c1(c(c(c(o1)o)o)o))o |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** hmfhbzshggewlo-aihaylrmsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 150.131 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RIBOKIN-RXN]] |
− | + | * [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]] | |
− | |||
− | |||
− | * [[RXN- | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]] |
− | |||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=α-d-ribofuranose}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=hmfhbzshggewlo-aihaylrmsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=150.131}} |
Latest revision as of 11:11, 18 March 2021
Contents
Metabolite CPD-10330
- common-name:
- α-d-ribofuranose
- smiles:
- c(c1(c(c(c(o1)o)o)o))o
- inchi-key:
- hmfhbzshggewlo-aihaylrmsa-n
- molecular-weight:
- 150.131