Difference between revisions of "CPD-10330"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ19199 == * transcription-direction: ** negative * right-end-position: ** 186308 * left-end-position: ** 162522 * centisome-position: ** 70.43085...") |
(Created page with "Category:metabolite == Metabolite ITP == * common-name: ** itp * smiles: ** c(op(=o)([o-])op([o-])(=o)op([o-])([o-])=o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) * inchi-ke...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite ITP == |
| − | * | + | * common-name: |
| − | ** | + | ** itp |
| − | * | + | * smiles: |
| − | ** | + | ** c(op(=o)([o-])op([o-])(=o)op([o-])([o-])=o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23))) |
| − | + | * inchi-key: | |
| − | + | ** haejpqiatwhalx-kqynxxcusa-j | |
| − | + | * molecular-weight: | |
| − | + | ** 504.137 | |
| − | = | + | == Reaction(s) known to consume the compound == |
| − | + | * [[ATP-DEAMINASE-RXN]] | |
| − | = | + | * [[ITCY]] |
| − | + | * [[ITPP]] | |
| − | * | + | * [[ITUP]] |
| − | + | * [[RXN-14120]] | |
| − | ** | + | * [[RXN0-5073]] |
| − | + | * [[RXN0-6382]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[ATID]] | |
| − | * | + | * [[ATIDm]] |
| − | + | * [[ATP-DEAMINASE-RXN]] | |
| − | ** | + | * [[RXN-14120]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | {{#set: common-name=itp}} | |
| − | + | {{#set: inchi-key=inchikey=haejpqiatwhalx-kqynxxcusa-j}} | |
| − | * [[ | + | {{#set: molecular-weight=504.137}} |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[ | ||
| − | * | ||
| − | * | ||
| − | * [[RXN- | ||
| − | |||
| − | |||
| − | * [[ | ||
| − | |||
| − | |||
| − | * [[ | ||
| − | |||
| − | |||
| − | |||
| − | == | ||
| − | * [[ | ||
| − | |||
| − | * [[ | ||
| − | |||
| − | * [[ | ||
| − | |||
| − | * [[ | ||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Revision as of 20:30, 18 December 2020
Contents
Metabolite ITP
- common-name:
- itp
- smiles:
- c(op(=o)([o-])op([o-])(=o)op([o-])([o-])=o)c1(oc(c(o)c(o)1)n3(c=nc2(c(=o)nc=nc=23)))
- inchi-key:
- haejpqiatwhalx-kqynxxcusa-j
- molecular-weight:
- 504.137
