Difference between revisions of "CPD-10332"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-308 == * common-name: ** d-nopaline * smiles: ** c([o-])(=o)ccc([n+]c(c(=o)[o-])cccnc(n)=[n+])c([o-])=o * inchi-key: ** lmkyzbgvkhtlt...") |
(Created page with "Category:metabolite == Metabolite CPD-9898 == * common-name: ** 3-methoxy-4-hydroxy-5-all-trans-nonaprenylbenzoate * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=c...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite CPD- | + | == Metabolite CPD-9898 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 3-methoxy-4-hydroxy-5-all-trans-nonaprenylbenzoate |
* smiles: | * smiles: | ||
| − | ** c( | + | ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c)c)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** fdppbyxdoxrdha-jsgwljpksa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 780.205 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-9281]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=3-methoxy-4-hydroxy-5-all-trans-nonaprenylbenzoate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=fdppbyxdoxrdha-jsgwljpksa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=780.205}} |
Revision as of 14:55, 5 January 2021
Contents
Metabolite CPD-9898
- common-name:
- 3-methoxy-4-hydroxy-5-all-trans-nonaprenylbenzoate
- smiles:
- cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(c(oc)=cc(c([o-])=o)=c1)o))c)c)c)c)c)c)c)c
- inchi-key:
- fdppbyxdoxrdha-jsgwljpksa-m
- molecular-weight:
- 780.205
