Difference between revisions of "CPD-10353"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ISOCHORISMATE == * common-name: ** isochorismate * smiles: ** c=c(c(=o)[o-])oc1(c=cc=c(c1o)c([o-])=o) * inchi-key: ** ntgwprccoqcmge-yumq...") |
(Created page with "Category:metabolite == Metabolite CPD-10353 == * common-name: ** (r)-acetoin * smiles: ** cc(o)c(=o)c * inchi-key: ** rowkjavdogwpat-gsvougtgsa-n * molecular-weight: ** 88...") |
||
| (3 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-10353 == |
* common-name: | * common-name: | ||
| − | ** | + | ** (r)-acetoin |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(o)c(=o)c |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** rowkjavdogwpat-gsvougtgsa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 88.106 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RR-BUTANEDIOL-DEHYDROGENASE-RXN]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RR-BUTANEDIOL-DEHYDROGENASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=(r)-acetoin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=rowkjavdogwpat-gsvougtgsa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=88.106}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-10353
- common-name:
- (r)-acetoin
- smiles:
- cc(o)c(=o)c
- inchi-key:
- rowkjavdogwpat-gsvougtgsa-n
- molecular-weight:
- 88.106
