Difference between revisions of "CPD-10420"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite D-Xylopyranose == * common-name: ** d-xylopyranose == Reaction(s) known to consume the compound == * D-XYLOSE-1-DEHYDROGENASE-NADP+-RXN...") |
(Created page with "Category:metabolite == Metabolite CPD-10576 == * common-name: ** 4-chlorosalicylate * smiles: ** c(c1(c=cc(cl)=cc=1o))([o-])=o * inchi-key: ** lwxfczxrfbuoor-uhfffaoysa-m...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite CPD-10576 == |
* common-name: | * common-name: | ||
− | ** | + | ** 4-chlorosalicylate |
+ | * smiles: | ||
+ | ** c(c1(c=cc(cl)=cc=1o))([o-])=o | ||
+ | * inchi-key: | ||
+ | ** lwxfczxrfbuoor-uhfffaoysa-m | ||
+ | * molecular-weight: | ||
+ | ** 171.56 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-9912]] | |
− | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=4-chlorosalicylate}} |
+ | {{#set: inchi-key=inchikey=lwxfczxrfbuoor-uhfffaoysa-m}} | ||
+ | {{#set: molecular-weight=171.56}} |
Revision as of 08:25, 15 March 2021
Contents
Metabolite CPD-10576
- common-name:
- 4-chlorosalicylate
- smiles:
- c(c1(c=cc(cl)=cc=1o))([o-])=o
- inchi-key:
- lwxfczxrfbuoor-uhfffaoysa-m
- molecular-weight:
- 171.56