Difference between revisions of "CPD-10420"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-5162 == * common-name: ** α-d-man-(1→3)-[α-d-man-(1→6)]-α-d-man-(1→4)-β-d-glcnac-(1→4)-&al...") |
(Created page with "Category:metabolite == Metabolite CPD-10420 == * common-name: ** 4-sulfomuconolactone * smiles: ** c([o-])(=o)cc1(s(=o)(=o)[o-])(c=cc(=o)o1) * inchi-key: ** weeoykxhmipyqx...") |
||
(3 intermediate revisions by 2 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-10420 == |
* common-name: | * common-name: | ||
− | ** | + | ** 4-sulfomuconolactone |
+ | * smiles: | ||
+ | ** c([o-])(=o)cc1(s(=o)(=o)[o-])(c=cc(=o)o1) | ||
+ | * inchi-key: | ||
+ | ** weeoykxhmipyqx-uhfffaoysa-l | ||
+ | * molecular-weight: | ||
+ | ** 220.153 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-9733]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=4-sulfomuconolactone}} |
+ | {{#set: inchi-key=inchikey=weeoykxhmipyqx-uhfffaoysa-l}} | ||
+ | {{#set: molecular-weight=220.153}} |
Latest revision as of 11:12, 18 March 2021
Contents
Metabolite CPD-10420
- common-name:
- 4-sulfomuconolactone
- smiles:
- c([o-])(=o)cc1(s(=o)(=o)[o-])(c=cc(=o)o1)
- inchi-key:
- weeoykxhmipyqx-uhfffaoysa-l
- molecular-weight:
- 220.153