Difference between revisions of "CPD-10420"
Jump to navigation
Jump to search
(Created page with "Category:gene == Gene SJ06513 == * transcription-direction: ** positive * right-end-position: ** 63788 * left-end-position: ** 53596 * centisome-position: ** 68.32303...") |
(Created page with "Category:metabolite == Metabolite PROTOPORPHYRIN_IX == * common-name: ** protoporphyrin ix * smiles: ** c=cc1(c(c)=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite PROTOPORPHYRIN_IX == |
| − | * | + | * common-name: |
| − | ** | + | ** protoporphyrin ix |
| − | * | + | * smiles: |
| − | ** | + | ** c=cc1(c(c)=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=cc3(c(c=c)=c(c)c(=cc=1n2)n=3))n4))=n5))) |
| − | + | * inchi-key: | |
| − | + | ** ksfovussgskxfi-ujjxfscmsa-l | |
| − | + | * molecular-weight: | |
| − | + | ** 560.651 | |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | * [[PROTOHEMEFERROCHELAT-RXN]] | |
| − | == | + | * [[RXN1F-20]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | + | * [[PPPGO]] | |
| − | ** | + | * [[PROTOHEMEFERROCHELAT-RXN]] |
| − | * | + | * [[PROTOPORGENOXI-RXN]] |
| − | ** | + | == Reaction(s) of unknown directionality == |
| − | * [[ | + | {{#set: common-name=protoporphyrin ix}} |
| − | * | + | {{#set: inchi-key=inchikey=ksfovussgskxfi-ujjxfscmsa-l}} |
| − | * | + | {{#set: molecular-weight=560.651}} |
| − | * [[RXN | ||
| − | * | ||
| − | |||
| − | == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Revision as of 20:31, 18 December 2020
Contents
Metabolite PROTOPORPHYRIN_IX
- common-name:
- protoporphyrin ix
- smiles:
- c=cc1(c(c)=c2(c=c5(c(c)=c(ccc([o-])=o)c(c=c4(c(ccc([o-])=o)=c(c)c(=cc3(c(c=c)=c(c)c(=cc=1n2)n=3))n4))=n5)))
- inchi-key:
- ksfovussgskxfi-ujjxfscmsa-l
- molecular-weight:
- 560.651
