Difference between revisions of "CPD-10472"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite MENADIOL == * common-name: ** menadiol * smiles: ** cc1(=cc(o)=c2(c=cc=cc(=c(o)1)2)) * inchi-key: ** zjtlzydqjhkrmq-uhfffaoysa-n * molecu...") |
(Created page with "Category:metabolite == Metabolite Protein-Histidines == * common-name: ** a [protein]-l-histidine == Reaction(s) known to consume the compound == * 2.7.13.3-RXN * RX...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite Protein-Histidines == |
* common-name: | * common-name: | ||
− | ** | + | ** a [protein]-l-histidine |
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[2.7.13.3-RXN]] | ||
+ | * [[RXN-15509]] | ||
+ | * [[RXN-15510]] | ||
+ | * [[RXN-15511]] | ||
+ | * [[RXN-15512]] | ||
+ | * [[RXN-17274]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-15509]] |
+ | * [[RXN-15510]] | ||
+ | * [[RXN-15511]] | ||
+ | * [[RXN-15512]] | ||
+ | * [[RXN-17131]] | ||
+ | * [[RXN-17132]] | ||
+ | * [[RXN-17133]] | ||
+ | * [[RXN-17276]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a [protein]-l-histidine}} |
− | |||
− |
Revision as of 14:54, 5 January 2021
Contents
Metabolite Protein-Histidines
- common-name:
- a [protein]-l-histidine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a [protein]-l-histidine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.