Difference between revisions of "CPD-10490"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 2C-METH-D-ERYTHRITOL-CYCLODIPHOSPHATE == * common-name: ** 2-c-methyl-d-erythritol-2,4-cyclodiphosphate * smiles: ** cc1(co)(op(=o)([o-])...") |
(Created page with "Category:metabolite == Metabolite CPD0-1905 == * common-name: ** 8-oxo-dgtp * smiles: ** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD0-1905 == |
* common-name: | * common-name: | ||
| − | ** | + | ** 8-oxo-dgtp |
* smiles: | * smiles: | ||
| − | ** | + | ** c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23))) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** buzogvvqwcxxdp-vpeninkcsa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 519.151 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | + | * [[RXN-11396]] | |
| − | * [[RXN- | + | * [[RXN-14205]] |
| − | * [[ | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-14205]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=8-oxo-dgtp}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=buzogvvqwcxxdp-vpeninkcsa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=519.151}} |
Revision as of 08:31, 15 March 2021
Contents
Metabolite CPD0-1905
- common-name:
- 8-oxo-dgtp
- smiles:
- c(op(=o)([o-])op(=o)(op([o-])([o-])=o)[o-])c1(oc(cc(o)1)n3(c(=o)nc2(c(=o)nc(n)=nc=23)))
- inchi-key:
- buzogvvqwcxxdp-vpeninkcsa-j
- molecular-weight:
- 519.151
