Difference between revisions of "CPD-10490"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN0-7008 RXN0-7008] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/...") |
(Created page with "Category:metabolite == Metabolite CPD-9406 == * common-name: ** (2s)-ethylmalonyl-coa * smiles: ** ccc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-]...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-9406 == |
| − | * | + | * common-name: |
| − | ** | + | ** (2s)-ethylmalonyl-coa |
| − | * | + | * smiles: |
| − | ** | + | ** ccc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c([o-])=o |
| − | == | + | * inchi-key: |
| − | + | ** vugzqvcbbbezqe-uqcjfraesa-i | |
| − | = | + | * molecular-weight: |
| − | * | + | ** 876.595 |
| − | ** | + | == Reaction(s) known to consume the compound == |
| − | ** | + | * [[RXN-13029]] |
| − | == | + | == Reaction(s) known to produce the compound == |
| − | * [[ | + | * [[RXN-13029]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | {{#set: common-name=(2s)-ethylmalonyl-coa}} |
| − | * | + | {{#set: inchi-key=inchikey=vugzqvcbbbezqe-uqcjfraesa-i}} |
| − | == | + | {{#set: molecular-weight=876.595}} |
| − | {{#set: | ||
| − | {{#set: | ||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
Revision as of 20:38, 18 December 2020
Contents
Metabolite CPD-9406
- common-name:
- (2s)-ethylmalonyl-coa
- smiles:
- ccc(c(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o)c([o-])=o
- inchi-key:
- vugzqvcbbbezqe-uqcjfraesa-i
- molecular-weight:
- 876.595
