Difference between revisions of "CPD-10546"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Tubulin-Heterodimers == * common-name: ** an α/β tubulin heterodimer == Reaction(s) known to consume the compound == == Reacti...")
(Created page with "Category:metabolite == Metabolite CPD-10546 == * common-name: ** methyl (indol-3-yl)acetate * smiles: ** coc(=o)cc2(c1(c(=cc=cc=1)nc=2)) * inchi-key: ** kthadmdgdnyqrx-uhf...")
 
(5 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Tubulin-Heterodimers ==
+
== Metabolite CPD-10546 ==
 
* common-name:
 
* common-name:
** an α/β tubulin heterodimer
+
** methyl (indol-3-yl)acetate
 +
* smiles:
 +
** coc(=o)cc2(c1(c(=cc=cc=1)nc=2))
 +
* inchi-key:
 +
** kthadmdgdnyqrx-uhfffaoysa-n
 +
* molecular-weight:
 +
** 189.213
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-10711]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[3.6.4.3-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an α/β tubulin heterodimer}}
+
{{#set: common-name=methyl (indol-3-yl)acetate}}
 +
{{#set: inchi-key=inchikey=kthadmdgdnyqrx-uhfffaoysa-n}}
 +
{{#set: molecular-weight=189.213}}

Latest revision as of 11:15, 18 March 2021

Metabolite CPD-10546

  • common-name:
    • methyl (indol-3-yl)acetate
  • smiles:
    • coc(=o)cc2(c1(c(=cc=cc=1)nc=2))
  • inchi-key:
    • kthadmdgdnyqrx-uhfffaoysa-n
  • molecular-weight:
    • 189.213

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality