Difference between revisions of "CPD-10589"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.1.2.19-RXN-CPD-196/WATER//CPD-195/CO-A/PROTON.35. 3.1.2.19-RXN-CPD-196/WATER//CPD-195/CO-A/PROTON...") |
(Created page with "Category:metabolite == Metabolite CPD-11408 == * common-name: ** triiodothyronine sulfate * smiles: ** c2(c=c(os(=o)(=o)[o-])c(=cc(oc1(c(=cc(=cc(i)=1)cc(c(=o)[o-])[n+])i))...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-11408 == |
| − | * | + | * common-name: |
| − | ** | + | ** triiodothyronine sulfate |
| − | == | + | * smiles: |
| − | + | ** c2(c=c(os(=o)(=o)[o-])c(=cc(oc1(c(=cc(=cc(i)=1)cc(c(=o)[o-])[n+])i))=2)i) | |
| − | == | + | * inchi-key: |
| − | == | + | ** xbqyqxvjbndcgy-lbprgkrzsa-m |
| − | + | * molecular-weight: | |
| − | * | + | ** 730.028 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | {{#set: | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-10615]] | |
| − | {{#set: | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=triiodothyronine sulfate}} | |
| − | {{#set: | + | {{#set: inchi-key=inchikey=xbqyqxvjbndcgy-lbprgkrzsa-m}} |
| − | + | {{#set: molecular-weight=730.028}} | |
| − | |||
Revision as of 20:37, 18 December 2020
Contents
Metabolite CPD-11408
- common-name:
- triiodothyronine sulfate
- smiles:
- c2(c=c(os(=o)(=o)[o-])c(=cc(oc1(c(=cc(=cc(i)=1)cc(c(=o)[o-])[n+])i))=2)i)
- inchi-key:
- xbqyqxvjbndcgy-lbprgkrzsa-m
- molecular-weight:
- 730.028
