Difference between revisions of "CPD-10590"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite P-AMINO-BENZOATE == * common-name: ** 4-aminobenzoate * smiles: ** c(=o)([o-])c1(c=cc(=cc=1)n) * inchi-key: ** alynczndiqevrv-uhfffaoysa-...") |
(Created page with "Category:metabolite == Metabolite Very-Long-Chain-oxoacyl-CoAs == * common-name: ** a very-long-chain oxoacyl-coa == Reaction(s) known to consume the compound == * RXN-7...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Very-Long-Chain-oxoacyl-CoAs == |
* common-name: | * common-name: | ||
| − | ** | + | ** a very-long-chain oxoacyl-coa |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-7698]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-7697]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a very-long-chain oxoacyl-coa}} |
| − | |||
| − | |||
Revision as of 15:29, 5 January 2021
Contents
Metabolite Very-Long-Chain-oxoacyl-CoAs
- common-name:
- a very-long-chain oxoacyl-coa
