Difference between revisions of "CPD-10600"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-19042 == * common-name: ** 2-hydroxyisobutyramide * smiles: ** cc(o)(c)c(=o)n * inchi-key: ** drymmxubdrjpds-uhfffaoysa-n * molecular...")
(Created page with "Category:metabolite == Metabolite CPD-10600 == * common-name: ** 4-hydroxybenzoyl-acetyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)c1(c=cc(o)=cc=1))cop(=o)(op...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-19042 ==
+
== Metabolite CPD-10600 ==
 
* common-name:
 
* common-name:
** 2-hydroxyisobutyramide
+
** 4-hydroxybenzoyl-acetyl-coa
 
* smiles:
 
* smiles:
** cc(o)(c)c(=o)n
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)c1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 
* inchi-key:
 
* inchi-key:
** drymmxubdrjpds-uhfffaoysa-n
+
** ovqojjjxnyhopr-fueukbnzsa-j
 
* molecular-weight:
 
* molecular-weight:
** 103.121
+
** 925.647
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17608]]
+
* [[RXN-11246]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-11245]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-hydroxyisobutyramide}}
+
{{#set: common-name=4-hydroxybenzoyl-acetyl-coa}}
{{#set: inchi-key=inchikey=drymmxubdrjpds-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=ovqojjjxnyhopr-fueukbnzsa-j}}
{{#set: molecular-weight=103.121}}
+
{{#set: molecular-weight=925.647}}

Latest revision as of 11:18, 18 March 2021

Metabolite CPD-10600

  • common-name:
    • 4-hydroxybenzoyl-acetyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)c1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
  • inchi-key:
    • ovqojjjxnyhopr-fueukbnzsa-j
  • molecular-weight:
    • 925.647

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality