Difference between revisions of "CPD-10600"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Ubiquinones == * common-name: ** a ubiquinone == Reaction(s) known to consume the compound == * 1.10.2.2-RXN * 1.5.5.1-RXN * NA...")
(Created page with "Category:metabolite == Metabolite CPD-10600 == * common-name: ** 4-hydroxybenzoyl-acetyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)c1(c=cc(o)=cc=1))cop(=o)(op...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Ubiquinones ==
+
== Metabolite CPD-10600 ==
 
* common-name:
 
* common-name:
** a ubiquinone
+
** 4-hydroxybenzoyl-acetyl-coa
 +
* smiles:
 +
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)c1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 +
* inchi-key:
 +
** ovqojjjxnyhopr-fueukbnzsa-j
 +
* molecular-weight:
 +
** 925.647
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.10.2.2-RXN]]
+
* [[RXN-11246]]
* [[1.5.5.1-RXN]]
 
* [[NADH-DEHYDROG-A-RXN]]
 
* [[RXN-15829]]
 
* [[RXN0-5260]]
 
* [[RXN0-5330]]
 
* [[RXN0-6491]]
 
* [[RXN0-7008]]
 
* [[RXN66-542]]
 
* [[RXN66-550]]
 
* [[SUCCINATE-DEHYDROGENASE-UBIQUINONE-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[1.10.2.2-RXN]]
+
* [[RXN-11245]]
* [[1.5.5.1-RXN]]
 
* [[NADH-DEHYDROG-A-RXN]]
 
* [[RXN-6883]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a ubiquinone}}
+
{{#set: common-name=4-hydroxybenzoyl-acetyl-coa}}
 +
{{#set: inchi-key=inchikey=ovqojjjxnyhopr-fueukbnzsa-j}}
 +
{{#set: molecular-weight=925.647}}

Latest revision as of 11:18, 18 March 2021

Metabolite CPD-10600

  • common-name:
    • 4-hydroxybenzoyl-acetyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)c1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
  • inchi-key:
    • ovqojjjxnyhopr-fueukbnzsa-j
  • molecular-weight:
    • 925.647

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality