Difference between revisions of "CPD-10600"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9225 RXN-9225] == * direction: ** left-to-right * ec-number: ** [http://enzyme.expasy.org/EC/2....")
 
(Created page with "Category:metabolite == Metabolite CPD-10600 == * common-name: ** 4-hydroxybenzoyl-acetyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)c1(c=cc(o)=cc=1))cop(=o)(op...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
[[Category:reaction]]
+
[[Category:metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9225 RXN-9225] ==
+
== Metabolite CPD-10600 ==
* direction:
+
* common-name:
** left-to-right
+
** 4-hydroxybenzoyl-acetyl-coa
* ec-number:
+
* smiles:
** [http://enzyme.expasy.org/EC/2.1.1.222 ec-2.1.1.222]
+
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)c1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
== Reaction formula ==
+
* inchi-key:
* 1 [[CPD-9854]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[CPD-9857]][c] '''+''' 1 [[PROTON]][c]
+
** ovqojjjxnyhopr-fueukbnzsa-j
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
* Gene: [[SJ16864]]
+
** 925.647
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-11246]]
* Gene: [[SJ13007]]
+
== Reaction(s) known to produce the compound ==
** Category: [[annotation]]
+
* [[RXN-11245]]
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
== Reaction(s) of unknown directionality ==
== Pathway(s) ==
+
{{#set: common-name=4-hydroxybenzoyl-acetyl-coa}}
* [[PWY-5855]], ubiquinol-7 biosynthesis (prokaryotic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5855 PWY-5855]
+
{{#set: inchi-key=inchikey=ovqojjjxnyhopr-fueukbnzsa-j}}
** '''3''' reactions found over '''8''' reactions in the full pathway
+
{{#set: molecular-weight=925.647}}
== Reconstruction information  ==
 
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
== External links  ==
 
* RHEA:
 
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=44593 44593]
 
{{#set: direction=left-to-right}}
 
{{#set: ec-number=ec-2.1.1.222}}
 
{{#set: nb gene associated=2}}
 
{{#set: nb pathway associated=1}}
 
{{#set: reconstruction category=annotation}}
 
{{#set: reconstruction tool=pathwaytools}}
 
{{#set: reconstruction comment=n.a}}
 
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:18, 18 March 2021

Metabolite CPD-10600

  • common-name:
    • 4-hydroxybenzoyl-acetyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)c1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
  • inchi-key:
    • ovqojjjxnyhopr-fueukbnzsa-j
  • molecular-weight:
    • 925.647

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality