Difference between revisions of "CPD-10600"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Glutamine-synthetase-adenylyl-Tyr == * common-name: ** a [glutamine synthetase]-o4-(5'-adenylyl)-l-tyrosine == Reaction(s) known to consu...")
(Created page with "Category:metabolite == Metabolite CPD-10600 == * common-name: ** 4-hydroxybenzoyl-acetyl-coa * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)c1(c=cc(o)=cc=1))cop(=o)(op...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Glutamine-synthetase-adenylyl-Tyr ==
+
== Metabolite CPD-10600 ==
 
* common-name:
 
* common-name:
** a [glutamine synthetase]-o4-(5'-adenylyl)-l-tyrosine
+
** 4-hydroxybenzoyl-acetyl-coa
 +
* smiles:
 +
** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)c1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
 +
* inchi-key:
 +
** ovqojjjxnyhopr-fueukbnzsa-j
 +
* molecular-weight:
 +
** 925.647
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-11246]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[GSADENYLATION-RXN]]
+
* [[RXN-11245]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a [glutamine synthetase]-o4-(5'-adenylyl)-l-tyrosine}}
+
{{#set: common-name=4-hydroxybenzoyl-acetyl-coa}}
 +
{{#set: inchi-key=inchikey=ovqojjjxnyhopr-fueukbnzsa-j}}
 +
{{#set: molecular-weight=925.647}}

Latest revision as of 11:18, 18 March 2021

Metabolite CPD-10600

  • common-name:
    • 4-hydroxybenzoyl-acetyl-coa
  • smiles:
    • cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)cc(=o)c1(c=cc(o)=cc=1))cop(=o)(op(=o)(occ2(c(op([o-])(=o)[o-])c(o)c(o2)n4(c3(=c(c(n)=nc=n3)n=c4))))[o-])[o-]
  • inchi-key:
    • ovqojjjxnyhopr-fueukbnzsa-j
  • molecular-weight:
    • 925.647

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality