Difference between revisions of "CPD-10608"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite GLUTAMATE-1-SEMIALDEHYDE == * common-name: ** (s)-4-amino-5-oxopentanoate * smiles: ** [ch](c(ccc([o-])=o)[n+])=o * inchi-key: ** mpuuqng...") |
(Created page with "Category:metabolite == Metabolite CPD-10608 == * common-name: ** trans-dienelactone * smiles: ** c1(=cc(=o)oc(=cc(=o)[o-])1) * inchi-key: ** ayfxpgxazmfwnh-onegzznksa-m *...") |
||
| (2 intermediate revisions by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-10608 == |
* common-name: | * common-name: | ||
| − | ** | + | ** trans-dienelactone |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(=cc(=o)oc(=cc(=o)[o-])1) |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ayfxpgxazmfwnh-onegzznksa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 139.087 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-9868]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=trans-dienelactone}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ayfxpgxazmfwnh-onegzznksa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=139.087}} |
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-10608
- common-name:
- trans-dienelactone
- smiles:
- c1(=cc(=o)oc(=cc(=o)[o-])1)
- inchi-key:
- ayfxpgxazmfwnh-onegzznksa-m
- molecular-weight:
- 139.087
