Difference between revisions of "CPD-10608"
Jump to navigation
Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-18202 RXN-18202] == * direction: ** reversible == Reaction formula == * 1 CPDQT-39[c] '''+'...") |
(Created page with "Category:metabolite == Metabolite CPD-10608 == * common-name: ** trans-dienelactone * smiles: ** c1(=cc(=o)oc(=cc(=o)[o-])1) * inchi-key: ** ayfxpgxazmfwnh-onegzznksa-m *...") |
||
| (9 intermediate revisions by 4 users not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:metabolite]] |
| − | == | + | == Metabolite CPD-10608 == |
| − | * | + | * common-name: |
| − | ** | + | ** trans-dienelactone |
| − | == | + | * smiles: |
| − | + | ** c1(=cc(=o)oc(=cc(=o)[o-])1) | |
| − | + | * inchi-key: | |
| − | * | + | ** ayfxpgxazmfwnh-onegzznksa-m |
| − | ** | + | * molecular-weight: |
| − | ** | + | ** 139.087 |
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-9868]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | == | + | == Reaction(s) of unknown directionality == |
| − | + | {{#set: common-name=trans-dienelactone}} | |
| − | == | + | {{#set: inchi-key=inchikey=ayfxpgxazmfwnh-onegzznksa-m}} |
| − | {{#set: | + | {{#set: molecular-weight=139.087}} |
| − | {{#set: | ||
| − | |||
| − | {{#set: | ||
| − | |||
| − | |||
| − | |||
Latest revision as of 11:16, 18 March 2021
Contents
Metabolite CPD-10608
- common-name:
- trans-dienelactone
- smiles:
- c1(=cc(=o)oc(=cc(=o)[o-])1)
- inchi-key:
- ayfxpgxazmfwnh-onegzznksa-m
- molecular-weight:
- 139.087
