Difference between revisions of "CPD-1063"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13892 RXN-13892] == * direction: ** left-to-right * common-name: ** poriferst-7-enol c-5 desatu...")
 
(Created page with "Category:metabolite == Metabolite CPD-1063 == * common-name: ** 5-(methylthio)ribulose 1-phosphate * smiles: ** cscc(o)c(o)c(=o)cop([o-])(=o)[o-] * inchi-key: ** cnsjryumv...")
 
(9 intermediate revisions by 5 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13892 RXN-13892] ==
+
== Metabolite CPD-1063 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** poriferst-7-enol c-5 desaturase
+
** 5-(methylthio)ribulose 1-phosphate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/1.14.19.20 ec-1.14.19.20]
+
** cscc(o)c(o)c(=o)cop([o-])(=o)[o-]
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[CPD-14901]][c] '''+''' 2 [[FERROCYTOCHROME-B5]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 2 [[PROTON]][c] '''=>''' 1 [[CPD-14900]][c] '''+''' 2 [[FERRICYTOCHROME-B5]][c] '''+''' 2 [[WATER]][c]
+
** cnsjryumvmwnmc-ritpcoansa-l
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ11625]]
+
** 258.182
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[R145-RXN]]
−
** Category: [[orthology]]
+
== Reaction(s) known to produce the compound ==
−
*** Source: [[output_pantograph_ectocarpus_siliculosus]], Tool: [[pantograph]], Assignment: n.a, Comment: n.a
+
* [[5.3.1.23-RXN]]
−
* Gene: [[SJ00834]]
+
* [[M5TRPI]]
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=5-(methylthio)ribulose 1-phosphate}}
−
== Pathway(s) ==
+
{{#set: inchi-key=inchikey=cnsjryumvmwnmc-ritpcoansa-l}}
−
* [[PWY-7155]], 7-dehydroporiferasterol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7155 PWY-7155]
+
{{#set: molecular-weight=258.182}}
−
** '''4''' reactions found over '''6''' reactions in the full pathway
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* category: [[orthology]]; source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== External links  ==
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=poriferst-7-enol c-5 desaturase}}
 
−
{{#set: ec-number=ec-1.14.19.20}}
 
−
{{#set: nb gene associated=2}}
 
−
{{#set: nb pathway associated=1}}
 
−
{{#set: reconstruction category=orthology|annotation}}
 
−
{{#set: reconstruction tool=pathwaytools|pantograph}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=output_pantograph_ectocarpus_siliculosus|saccharina_japonica_genome}}
 

Latest revision as of 11:16, 18 March 2021

Metabolite CPD-1063

  • common-name:
    • 5-(methylthio)ribulose 1-phosphate
  • smiles:
    • cscc(o)c(o)c(=o)cop([o-])(=o)[o-]
  • inchi-key:
    • cnsjryumvmwnmc-ritpcoansa-l
  • molecular-weight:
    • 258.182

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-1063&oldid=139174"