Difference between revisions of "CPD-10660"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-490 == * common-name: ** α-d-xylose 1-phosphate * smiles: ** c1(c(c(c(co1)o)o)o)op([o-])([o-])=o * inchi-key: ** ilxhfxfppzgenn...")
(Created page with "Category:metabolite == Metabolite CPD-10660 == * common-name: ** 3-chlorobenzaldehyde * smiles: ** c(=o)c1(c=cc=c(cl)c=1) * inchi-key: ** srwilaksarhzpr-uhfffaoysa-n * mol...")
 
(2 intermediate revisions by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-490 ==
+
== Metabolite CPD-10660 ==
 
* common-name:
 
* common-name:
** α-d-xylose 1-phosphate
+
** 3-chlorobenzaldehyde
 
* smiles:
 
* smiles:
** c1(c(c(c(co1)o)o)o)op([o-])([o-])=o
+
** c(=o)c1(c=cc=c(cl)c=1)
 
* inchi-key:
 
* inchi-key:
** ilxhfxfppzgenn-kkqcnmdgsa-l
+
** srwilaksarhzpr-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 228.095
+
** 140.569
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[2.7.7.11-RXN]]
+
* [[RXN-9910]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[2.7.7.11-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=α-d-xylose 1-phosphate}}
+
{{#set: common-name=3-chlorobenzaldehyde}}
{{#set: inchi-key=inchikey=ilxhfxfppzgenn-kkqcnmdgsa-l}}
+
{{#set: inchi-key=inchikey=srwilaksarhzpr-uhfffaoysa-n}}
{{#set: molecular-weight=228.095}}
+
{{#set: molecular-weight=140.569}}

Latest revision as of 11:12, 18 March 2021

Metabolite CPD-10660

  • common-name:
    • 3-chlorobenzaldehyde
  • smiles:
    • c(=o)c1(c=cc=c(cl)c=1)
  • inchi-key:
    • srwilaksarhzpr-uhfffaoysa-n
  • molecular-weight:
    • 140.569

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality