Difference between revisions of "CPD-10663"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-HEXAPRENYL-4-HYDROXYBENZOATE == * common-name: ** 3-hexaprenyl-4-hydroxybenzoate * smiles: ** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(...")
(Created page with "Category:metabolite == Metabolite CPD-8541 == * common-name: ** a [protein]-n4-(n-acetyl-β-d-glucosaminyl)-l-asparagine == Reaction(s) known to consume the compound =...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-HEXAPRENYL-4-HYDROXYBENZOATE ==
+
== Metabolite CPD-8541 ==
 
* common-name:
 
* common-name:
** 3-hexaprenyl-4-hydroxybenzoate
+
** a [protein]-n4-(n-acetyl-β-d-glucosaminyl)-l-asparagine
* smiles:
 
** cc(c)=cccc(=cccc(=cccc(=cccc(=cccc(=ccc1(=c(o)c=cc(c(=o)[o-])=c1))c)c)c)c)c
 
* inchi-key:
 
** lkmqqqabigihgl-laaqxviisa-m
 
* molecular-weight:
 
** 545.824
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[2.4.1.94-RXN]]
 +
* [[3.5.1.52-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-9003]]
+
* [[2.4.1.94-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=3-hexaprenyl-4-hydroxybenzoate}}
+
{{#set: common-name=a [protein]-n4-(n-acetyl-β-d-glucosaminyl)-l-asparagine}}
{{#set: inchi-key=inchikey=lkmqqqabigihgl-laaqxviisa-m}}
 
{{#set: molecular-weight=545.824}}
 

Revision as of 08:26, 15 March 2021

Metabolite CPD-8541

  • common-name:
    • a [protein]-n4-(n-acetyl-β-d-glucosaminyl)-l-asparagine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "a [protein]-n4-(n-acetyl-β-d-glucosaminyl)-l-asparagine" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.