Difference between revisions of "CPD-10663"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ06122 == * transcription-direction: ** negative * right-end-position: ** 37802 * left-end-position: ** 12832 * centisome-position: ** 15.349648...")
(Created page with "Category:metabolite == Metabolite CPD-10663 == * common-name: ** 5-chlorosalicylate * smiles: ** c(c1(c=c(cl)c=cc=1o))([o-])=o * inchi-key: ** nkbasrxwgagqdp-uhfffaoysa-m...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ06122 ==
+
== Metabolite CPD-10663 ==
−
* transcription-direction:
+
* common-name:
−
** negative
+
** 5-chlorosalicylate
−
* right-end-position:
+
* smiles:
−
** 37802
+
** c(c1(c=c(cl)c=cc=1o))([o-])=o
−
* left-end-position:
+
* inchi-key:
−
** 12832
+
** nkbasrxwgagqdp-uhfffaoysa-m
−
* centisome-position:
+
* molecular-weight:
−
** 15.349648   
+
** 171.56
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-9914]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[2.5.1.19-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=5-chlorosalicylate}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=nkbasrxwgagqdp-uhfffaoysa-m}}
−
** Category: [[orthology]]
+
{{#set: molecular-weight=171.56}}
−
*** source: [[output_pantograph_nannochloropsis_salina]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_arabidopsis_thaliana]]; tool: [[pantograph]]; comment: n.a
 
−
*** source: [[output_pantograph_ectocarpus_siliculosus]]; tool: [[pantograph]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-6163]]
 
−
** '''6''' reactions found over '''5''' reactions in the full pathway
 
−
{{#set: transcription-direction=negative}}
 
−
{{#set: right-end-position=37802}}
 
−
{{#set: left-end-position=12832}}
 
−
{{#set: centisome-position=15.349648    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=1}}
 
−
{{#set: nb pathway associated=1}}
 

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-10663

  • common-name:
    • 5-chlorosalicylate
  • smiles:
    • c(c1(c=c(cl)c=cc=1o))([o-])=o
  • inchi-key:
    • nkbasrxwgagqdp-uhfffaoysa-m
  • molecular-weight:
    • 171.56

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-10663&oldid=137737"