Difference between revisions of "CPD-10663"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2R-3R-Dihydroflavonols == * common-name: ** a (2r,3r)-dihydroflavonol == Reaction(s) known to consume the compound == * RXN-17678 ==...")
(Created page with "Category:metabolite == Metabolite CPD-10663 == * common-name: ** 5-chlorosalicylate * smiles: ** c(c1(c=c(cl)c=cc=1o))([o-])=o * inchi-key: ** nkbasrxwgagqdp-uhfffaoysa-m...")
 
(4 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2R-3R-Dihydroflavonols ==
+
== Metabolite CPD-10663 ==
 
* common-name:
 
* common-name:
** a (2r,3r)-dihydroflavonol
+
** 5-chlorosalicylate
 +
* smiles:
 +
** c(c1(c=c(cl)c=cc=1o))([o-])=o
 +
* inchi-key:
 +
** nkbasrxwgagqdp-uhfffaoysa-m
 +
* molecular-weight:
 +
** 171.56
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17678]]
+
* [[RXN-9914]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a (2r,3r)-dihydroflavonol}}
+
{{#set: common-name=5-chlorosalicylate}}
 +
{{#set: inchi-key=inchikey=nkbasrxwgagqdp-uhfffaoysa-m}}
 +
{{#set: molecular-weight=171.56}}

Latest revision as of 11:13, 18 March 2021

Metabolite CPD-10663

  • common-name:
    • 5-chlorosalicylate
  • smiles:
    • c(c1(c=c(cl)c=cc=1o))([o-])=o
  • inchi-key:
    • nkbasrxwgagqdp-uhfffaoysa-m
  • molecular-weight:
    • 171.56

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality