Difference between revisions of "CPD-10663"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-511 == * common-name: ** pantetheine * smiles: ** cc(c(o)c(=o)nccc(nccs)=o)(c)co * inchi-key: ** znxzgrmvnnhpca-vifpvbqesa-n * molecu...") |
(Created page with "Category:metabolite == Metabolite Phenyl-Acetates == * common-name: ** a phenyl acetate == Reaction(s) known to consume the compound == * ARYLESTERASE-RXN == Reaction(...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Phenyl-Acetates == |
* common-name: | * common-name: | ||
| − | ** | + | ** a phenyl acetate |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[ARYLESTERASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a phenyl acetate}} |
| − | |||
| − | |||
Revision as of 14:55, 5 January 2021
Contents
Metabolite Phenyl-Acetates
- common-name:
- a phenyl acetate
