Difference between revisions of "CPD-10664"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:gene == Gene SJ13607 == * transcription-direction: ** positive * right-end-position: ** 170445 * left-end-position: ** 162284 * centisome-position: ** 48.715355...")
(Created page with "Category:metabolite == Metabolite CPD-10664 == * common-name: ** 5-methylsalicylate * smiles: ** cc1(=cc(=c(c=c1)o)c([o-])=o) * inchi-key: ** dlgbegbhxsaqoc-uhfffaoysa-m *...")
 
(8 intermediate revisions by 4 users not shown)
Line 1: Line 1:
−
[[Category:gene]]
+
[[Category:metabolite]]
−
== Gene SJ13607 ==
+
== Metabolite CPD-10664 ==
−
* transcription-direction:
+
* common-name:
−
** positive
+
** 5-methylsalicylate
−
* right-end-position:
+
* smiles:
−
** 170445
+
** cc1(=cc(=c(c=c1)o)c([o-])=o)
−
* left-end-position:
+
* inchi-key:
−
** 162284
+
** dlgbegbhxsaqoc-uhfffaoysa-m
−
* centisome-position:
+
* molecular-weight:
−
** 48.715355   
+
** 151.141
−
== Organism(s) associated with this gene  ==
+
== Reaction(s) known to consume the compound ==
−
* [[S.japonica_carotenoid_curated]]
+
* [[RXN-10079]]
−
== Reaction(s) associated ==
+
== Reaction(s) known to produce the compound ==
−
* [[2.4.1.151-RXN]]
+
== Reaction(s) of unknown directionality ==
−
** Category: [[annotation]]
+
{{#set: common-name=5-methylsalicylate}}
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
+
{{#set: inchi-key=inchikey=dlgbegbhxsaqoc-uhfffaoysa-m}}
−
* [[RXN-1225]]
+
{{#set: molecular-weight=151.141}}
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
* [[RXN-18302]]
 
−
** Category: [[annotation]]
 
−
*** source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== Pathway(s) associated ==
 
−
* [[PWY-7434]]
 
−
** '''5''' reactions found over '''8''' reactions in the full pathway
 
−
* [[PWY-401]]
 
−
** '''2''' reactions found over '''5''' reactions in the full pathway
 
−
* [[PWY-7666]]
 
−
** '''1''' reactions found over '''3''' reactions in the full pathway
 
−
* [[PWY-7840]]
 
−
** '''3''' reactions found over '''5''' reactions in the full pathway
 
−
{{#set: transcription-direction=positive}}
 
−
{{#set: right-end-position=170445}}
 
−
{{#set: left-end-position=162284}}
 
−
{{#set: centisome-position=48.715355    }}
 
−
{{#set: organism associated=S.japonica_carotenoid_curated}}
 
−
{{#set: nb reaction associated=3}}
 
−
{{#set: nb pathway associated=4}}
 

Latest revision as of 11:14, 18 March 2021

Metabolite CPD-10664

  • common-name:
    • 5-methylsalicylate
  • smiles:
    • cc1(=cc(=c(c=c1)o)c([o-])=o)
  • inchi-key:
    • dlgbegbhxsaqoc-uhfffaoysa-m
  • molecular-weight:
    • 151.141

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-10664&oldid=138240"