Difference between revisions of "CPD-10792"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 2-AMINOMUCONATE_SEMIALDEHYDE == * common-name: ** (2z,4e)-2-amino-6-oxohexa-2,4-dienoate * smiles: ** c(c=c(c([o-])=o)n)=c[ch]=o * inchi-...")
(Created page with "Category:metabolite == Metabolite CPD-10792 == * common-name: ** 2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate * smiles: ** cc(=o)c(o)c(o)cc([n+])c([o-])=o * inchi-key: **...")
 
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 2-AMINOMUCONATE_SEMIALDEHYDE ==
+
== Metabolite CPD-10792 ==
 
* common-name:
 
* common-name:
** (2z,4e)-2-amino-6-oxohexa-2,4-dienoate
+
** 2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate
 
* smiles:
 
* smiles:
** c(c=c(c([o-])=o)n)=c[ch]=o
+
** cc(=o)c(o)c(o)cc([n+])c([o-])=o
 
* inchi-key:
 
* inchi-key:
** qcgtzpzkjptaep-wftyeqlwsa-m
+
** ifmhgoadxgywmo-kvqbguixsa-n
 
* molecular-weight:
 
* molecular-weight:
** 140.118
+
** 191.183
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-10032]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[AMINO-CARBOXYMUCONATE-SEMIALDEHYDE-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(2z,4e)-2-amino-6-oxohexa-2,4-dienoate}}
+
{{#set: common-name=2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate}}
{{#set: inchi-key=inchikey=qcgtzpzkjptaep-wftyeqlwsa-m}}
+
{{#set: inchi-key=inchikey=ifmhgoadxgywmo-kvqbguixsa-n}}
{{#set: molecular-weight=140.118}}
+
{{#set: molecular-weight=191.183}}

Latest revision as of 11:18, 18 March 2021

Metabolite CPD-10792

  • common-name:
    • 2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate
  • smiles:
    • cc(=o)c(o)c(o)cc([n+])c([o-])=o
  • inchi-key:
    • ifmhgoadxgywmo-kvqbguixsa-n
  • molecular-weight:
    • 191.183

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality