Difference between revisions of "CPD-10792"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11836 RXN-11836] == * direction: ** left-to-right * common-name: ** 23s rrna pseudouridine2605...")
(Created page with "Category:metabolite == Metabolite CPD-10792 == * common-name: ** 2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate * smiles: ** cc(=o)c(o)c(o)cc([n+])c([o-])=o * inchi-key: **...")
 
(8 intermediate revisions by 3 users not shown)
Line 1: Line 1:
−
[[Category:reaction]]
+
[[Category:metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11836 RXN-11836] ==
+
== Metabolite CPD-10792 ==
−
* direction:
 
−
** left-to-right
 
 
* common-name:
 
* common-name:
−
** 23s rrna pseudouridine2605 synthase
+
** 2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate
−
* ec-number:
+
* smiles:
−
** [http://enzyme.expasy.org/EC/5.4.99.22 ec-5.4.99.22]
+
** cc(=o)c(o)c(o)cc([n+])c([o-])=o
−
== Reaction formula ==
+
* inchi-key:
−
* 1 [[23S-rRNA-uridine2605]][c] '''=>''' 1 [[23S-rRNA-pseudouridine2605]][c]
+
** ifmhgoadxgywmo-kvqbguixsa-n
−
== Gene(s) associated with this reaction  ==
+
* molecular-weight:
−
* Gene: [[SJ05951]]
+
** 191.183
−
** Category: [[annotation]]
+
== Reaction(s) known to consume the compound ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
* [[RXN-10032]]
−
* Gene: [[SJ07661]]
+
== Reaction(s) known to produce the compound ==
−
** Category: [[annotation]]
+
== Reaction(s) of unknown directionality ==
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
+
{{#set: common-name=2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate}}
−
* Gene: [[SJ11677]]
+
{{#set: inchi-key=inchikey=ifmhgoadxgywmo-kvqbguixsa-n}}
−
** Category: [[annotation]]
+
{{#set: molecular-weight=191.183}}
−
*** Source: [[saccharina_japonica_genome]], Tool: [[pathwaytools]], Assignment: ec-number, Comment: n.a
 
−
== Pathway(s) ==
 
−
== Reconstruction information  ==
 
−
* category: [[annotation]]; source: [[saccharina_japonica_genome]]; tool: [[pathwaytools]]; comment: n.a
 
−
== External links  ==
 
−
* RHEA:
 
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=42521 42521]
 
−
{{#set: direction=left-to-right}}
 
−
{{#set: common-name=23s rrna pseudouridine2605 synthase}}
 
−
{{#set: ec-number=ec-5.4.99.22}}
 
−
{{#set: nb gene associated=3}}
 
−
{{#set: nb pathway associated=0}}
 
−
{{#set: reconstruction category=annotation}}
 
−
{{#set: reconstruction tool=pathwaytools}}
 
−
{{#set: reconstruction comment=n.a}}
 
−
{{#set: reconstruction source=saccharina_japonica_genome}}
 

Latest revision as of 11:18, 18 March 2021

Metabolite CPD-10792

  • common-name:
    • 2-amino-3,7-dideoxy-d-threo-hept-6-ulosonate
  • smiles:
    • cc(=o)c(o)c(o)cc([n+])c([o-])=o
  • inchi-key:
    • ifmhgoadxgywmo-kvqbguixsa-n
  • molecular-weight:
    • 191.183

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "https://gem-aureme.genouest.org/sjapgem/index.php?title=CPD-10792&oldid=139854"